C15H25O6P2S-3 — CID 23420293
phosphonatooxy-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylphosphinate (PubChem CID 23420293) has the molecular formula C15H25O6P2S-3 and a molecular weight of 395.37 g/mol. Its IUPAC name is phosphonatooxy-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylphosphinate.
| Compound Name | phosphonatooxy-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylphosphinate |
|---|---|
| PubChem CID | 23420293 |
| Molecular Formula | C15H25O6P2S-3 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | phosphonatooxy-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylphosphinate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSP(=O)([O-])OP(=O)([O-])[O-] |
| InChI | InChI=1S/C15H28O6P2S/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-24-23(19,20)21-22(16,17)18/h7,9,11H,5-6,8,10,12H2,1-4H3,(H,19,20)(H2,16,17,18)/p-3/b14-9+,15-11+ |
| InChIKey | MYMLCRQRXFRQGP-YFVJMOTDSA-K |
| XLogP | 3.45 |
| TPSA | 112.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|