C35H35IrN3S-2 — CID 154588048
CID 154588048 (PubChem CID 154588048) has the molecular formula C35H35IrN3S-2 and a molecular weight of 727.00 g/mol.
| Compound Name | CID 154588048 |
|---|---|
| PubChem CID | 154588048 |
| Molecular Formula | C35H35IrN3S-2 |
| Molecular Weight | 727.00 g/mol |
| Exact Mass | 727.25 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(C2=NC=C(C)C(C)C2)cc1.[2H]c1ccnc(-c2[c-]cccc3cncc(C4CCCC4)c3sc2)c1[2H].[Ir] |
| InChI | InChI=1S/C21H19N2S.C14H16N.Ir/c1-2-8-16(7-1)19-14-22-13-17-9-3-4-10-18(15-24-21(17)19)20-11-5-6-12-23-20;1-10-4-6-13(7-5-10)14-8-11(2)12(3)9-15-14;/h3-6,9,11-16H,1-2,7-8H2;4-6,9,11H,8H2,1-3H3;/q2*-1;/b9-3-,18-15+;;/i5D,11D;1D3; |
| InChIKey | DJXOQGBHVDMPLI-WRFOGBJNSA-N |
| XLogP | 9.47 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.00 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|