C52H36I2IrN2O2-2 — CID 154588807
(Z)-1-[2-[3,5-bis[2-(2-iodo-4-pyridin-2-ylbenzene-5-id-1-yl)phenyl]phenyl]phenyl]-5-hydroxyhex-4-en-3-one;iridium (PubChem CID 154588807) has the molecular formula C52H36I2IrN2O2-2 and a molecular weight of 1166.90 g/mol. Its IUPAC name is (Z)-1-[2-[3,5-bis[2-(2-iodo-4-pyridin-2-ylbenzene-5-id-1-yl)phenyl]phenyl]phenyl]-5-hydroxyhex-4-en-3-one;iridium.
| Compound Name | (Z)-1-[2-[3,5-bis[2-(2-iodo-4-pyridin-2-ylbenzene-5-id-1-yl)phenyl]phenyl]phenyl]-5-hydroxyhex-4-en-3-one;iridium |
|---|---|
| PubChem CID | 154588807 |
| Molecular Formula | C52H36I2IrN2O2-2 |
| Molecular Weight | 1166.90 g/mol |
| Exact Mass | 1167.05 |
| IUPAC Name | (Z)-1-[2-[3,5-bis[2-(2-iodo-4-pyridin-2-ylbenzene-5-id-1-yl)phenyl]phenyl]phenyl]-5-hydroxyhex-4-en-3-one;iridium |
| SMILES | C/C(O)=C/C(=O)CCc1ccccc1-c1cc(-c2ccccc2-c2c[c-]c(-c3ccccn3)cc2I)cc(-c2ccccc2-c2c[c-]c(-c3ccccn3)cc2I)c1.[Ir] |
| InChI | InChI=1S/C52H36I2N2O2.Ir/c1-34(57)28-41(58)23-20-35-12-2-3-13-42(35)38-29-39(43-14-4-6-16-45(43)47-24-21-36(32-49(47)53)51-18-8-10-26-55-51)31-40(30-38)44-15-5-7-17-46(44)48-25-22-37(33-50(48)54)52-19-9-11-27-56-52;/h2-19,24-33,57H,20,23H2,1H3;/q-2;/b34-28-; |
| InChIKey | YLCXEKJXIBFKFL-SWIOYBRISA-N |
| XLogP | 13.92 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1166.90 |
| LogP ≤ 5 | 13.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|