C12H20N2O3 — CID 154593899
5-(2,5,5-trimethyl-3-oxohexyl)imidazolidine-2,4-dione (PubChem CID 154593899) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 5-(2,5,5-trimethyl-3-oxohexyl)imidazolidine-2,4-dione.
| Compound Name | 5-(2,5,5-trimethyl-3-oxohexyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 154593899 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 5-(2,5,5-trimethyl-3-oxohexyl)imidazolidine-2,4-dione |
| SMILES | CC(CC1NC(=O)NC1=O)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C12H20N2O3/c1-7(9(15)6-12(2,3)4)5-8-10(16)14-11(17)13-8/h7-8H,5-6H2,1-4H3,(H2,13,14,16,17) |
| InChIKey | FAUXNHYGMRJDTR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|