C14H16N4O4S — CID 154594063
O-[2-(deuteriomethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] imidazole-1-carbothioate (PubChem CID 154594063) has the molecular formula C14H16N4O4S and a molecular weight of 337.38 g/mol. Its IUPAC name is O-[2-(deuteriomethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] imidazole-1-carbothioate.
| Compound Name | O-[2-(deuteriomethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] imidazole-1-carbothioate |
|---|---|
| PubChem CID | 154594063 |
| Molecular Formula | C14H16N4O4S |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | O-[2-(deuteriomethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] imidazole-1-carbothioate |
| SMILES | [2H]CC1OC(n2cc(C)c(=O)[nH]c2=O)CC1OC(=S)n1ccnc1 |
| InChI | InChI=1S/C14H16N4O4S/c1-8-6-18(13(20)16-12(8)19)11-5-10(9(2)21-11)22-14(23)17-4-3-15-7-17/h3-4,6-7,9-11H,5H2,1-2H3,(H,16,19,20)/i2D |
| InChIKey | PGHHNGVZRIRRLO-VMNATFBRSA-N |
| XLogP | 0.57 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|