C42H38F4O5S2 — CID 154594471
4-[2,6-dicyclohexyl-4-(3-diphenylsulfoniophenoxy)phenoxy]-2,3,5,6-tetrafluorobenzenesulfonate (PubChem CID 154594471) has the molecular formula C42H38F4O5S2 and a molecular weight of 762.89 g/mol. Its IUPAC name is 4-[2,6-dicyclohexyl-4-(3-diphenylsulfoniophenoxy)phenoxy]-2,3,5,6-tetrafluorobenzenesulfonate.
| Compound Name | 4-[2,6-dicyclohexyl-4-(3-diphenylsulfoniophenoxy)phenoxy]-2,3,5,6-tetrafluorobenzenesulfonate |
|---|---|
| PubChem CID | 154594471 |
| Molecular Formula | C42H38F4O5S2 |
| Molecular Weight | 762.89 g/mol |
| Exact Mass | 762.21 |
| IUPAC Name | 4-[2,6-dicyclohexyl-4-(3-diphenylsulfoniophenoxy)phenoxy]-2,3,5,6-tetrafluorobenzenesulfonate |
| SMILES | O=S(=O)([O-])c1c(F)c(F)c(Oc2c(C3CCCCC3)cc(Oc3cccc([S+](c4ccccc4)c4ccccc4)c3)cc2C2CCCCC2)c(F)c1F |
| InChI | InChI=1S/C42H38F4O5S2/c43-36-38(45)42(53(47,48)49)39(46)37(44)41(36)51-40-34(27-14-5-1-6-15-27)25-30(26-35(40)28-16-7-2-8-17-28)50-29-18-13-23-33(24-29)52(31-19-9-3-10-20-31)32-21-11-4-12-22-32/h3-4,9-13,18-28H,1-2,5-8,14-17H2 |
| InChIKey | VWNBJMBHZLWPDD-UHFFFAOYSA-N |
| XLogP | 11.92 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.89 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|