C34H42N4O2S+2 — CID 154597270
3-[ethyl-[7-methoxy-4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]propyl-(2-hydroxyethyl)-dimethylazanium (PubChem CID 154597270) has the molecular formula C34H42N4O2S+2 and a molecular weight of 570.80 g/mol. Its IUPAC name is 3-[ethyl-[7-methoxy-4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]propyl-(2-hydroxyethyl)-dimethylazanium.
| Compound Name | 3-[ethyl-[7-methoxy-4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]propyl-(2-hydroxyethyl)-dimethylazanium |
|---|---|
| PubChem CID | 154597270 |
| Molecular Formula | C34H42N4O2S+2 |
| Molecular Weight | 570.80 g/mol |
| Exact Mass | 570.30 |
| IUPAC Name | 3-[ethyl-[7-methoxy-4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]propyl-(2-hydroxyethyl)-dimethylazanium |
| SMILES | CCN(CCC[N+](C)(C)CCO)c1cc(C=C2Sc3ccccc3N2C)c2ccc(OC)cc2[n+]1-c1ccccc1 |
| InChI | InChI=1S/C34H42N4O2S/c1-6-36(19-12-20-38(3,4)21-22-39)33-23-26(24-34-35(2)30-15-10-11-16-32(30)41-34)29-18-17-28(40-5)25-31(29)37(33)27-13-8-7-9-14-27/h7-11,13-18,23-25,39H,6,12,19-22H2,1-5H3/q+2 |
| InChIKey | RYFSROKQILPLGA-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 39.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.80 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|