C20H20N2O3 — CID 154598099
benzyl N-[(6R,7S)-4-oxo-6-phenyl-5-azaspiro[2.4]heptan-7-yl]carbamate (PubChem CID 154598099) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is benzyl N-[(6R,7S)-4-oxo-6-phenyl-5-azaspiro[2.4]heptan-7-yl]carbamate.
| Compound Name | benzyl N-[(6R,7S)-4-oxo-6-phenyl-5-azaspiro[2.4]heptan-7-yl]carbamate |
|---|---|
| PubChem CID | 154598099 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | benzyl N-[(6R,7S)-4-oxo-6-phenyl-5-azaspiro[2.4]heptan-7-yl]carbamate |
| SMILES | O=C(N[C@@H]1[C@@H](c2ccccc2)NC(=O)C12CC2)OCc1ccccc1 |
| InChI | InChI=1S/C20H20N2O3/c23-18-20(11-12-20)17(16(21-18)15-9-5-2-6-10-15)22-19(24)25-13-14-7-3-1-4-8-14/h1-10,16-17H,11-13H2,(H,21,23)(H,22,24)/t16-,17-/m1/s1 |
| InChIKey | GNVUXJZJFULWTC-IAGOWNOFSA-N |
| XLogP | 2.93 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |