C34H22IrNS- — CID 154600475
CID 154600475 (PubChem CID 154600475) has the molecular formula C34H22IrNS- and a molecular weight of 668.84 g/mol.
| Compound Name | CID 154600475 |
|---|---|
| PubChem CID | 154600475 |
| Molecular Formula | C34H22IrNS- |
| Molecular Weight | 668.84 g/mol |
| Exact Mass | 669.11 |
| IUPAC Name | — |
| SMILES | Cc1ccc(-c2ccnc(-c3[c-]cc4sc5c6ccc7c8c6c(cc5c4c3)CC=C8CC=C7)c2)cc1.[Ir] |
| InChI | InChI=1S/C34H22NS.Ir/c1-20-5-7-21(8-6-20)24-15-16-35-30(19-24)25-12-14-31-28(17-25)29-18-26-10-9-22-3-2-4-23-11-13-27(34(29)36-31)33(26)32(22)23;/h2,4-9,11,13-19H,3,10H2,1H3;/q-1; |
| InChIKey | CLUNNUFQGMHZFA-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.84 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|