C26H28IrN- — CID 140790019
iridium;4-phenyl-2-(5,5,9,9-tetramethyl-2,6,7,8-tetrahydrobenzo[7]annulen-2-id-3-yl)pyridine (PubChem CID 140790019) has the molecular formula C26H28IrN- and a molecular weight of 546.73 g/mol. Its IUPAC name is iridium;4-phenyl-2-(5,5,9,9-tetramethyl-2,6,7,8-tetrahydrobenzo[7]annulen-2-id-3-yl)pyridine.
| Compound Name | iridium;4-phenyl-2-(5,5,9,9-tetramethyl-2,6,7,8-tetrahydrobenzo[7]annulen-2-id-3-yl)pyridine |
|---|---|
| PubChem CID | 140790019 |
| Molecular Formula | C26H28IrN- |
| Molecular Weight | 546.73 g/mol |
| Exact Mass | 547.19 |
| IUPAC Name | iridium;4-phenyl-2-(5,5,9,9-tetramethyl-2,6,7,8-tetrahydrobenzo[7]annulen-2-id-3-yl)pyridine |
| SMILES | CC1(C)CCCC(C)(C)c2cc(-c3cc(-c4ccccc4)ccn3)[c-]cc21.[Ir] |
| InChI | InChI=1S/C26H28N.Ir/c1-25(2)14-8-15-26(3,4)23-17-21(11-12-22(23)25)24-18-20(13-16-27-24)19-9-6-5-7-10-19;/h5-7,9-10,12-13,16-18H,8,14-15H2,1-4H3;/q-1; |
| InChIKey | WQFJQWXPOXVDNB-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.73 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|