C23H22IrN- — CID 140756488
CID 140756488 (PubChem CID 140756488) has the molecular formula C23H22IrN- and a molecular weight of 504.65 g/mol.
| Compound Name | CID 140756488 |
|---|---|
| PubChem CID | 140756488 |
| Molecular Formula | C23H22IrN- |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | — |
| SMILES | CC12CCC(C)(CC1)c1cc(-c3cc4ccccc4cn3)[c-]cc12.[Ir] |
| InChI | InChI=1S/C23H22N.Ir/c1-22-9-11-23(2,12-10-22)20-13-17(7-8-19(20)22)21-14-16-5-3-4-6-18(16)15-24-21;/h3-6,8,13-15H,9-12H2,1-2H3;/q-1; |
| InChIKey | IZARGLNTPSHEAJ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|