C27H30IrN- — CID 140789933
2-(5,5,6,7,8,8-hexamethyl-6,7-dihydro-3H-naphthalen-3-id-2-yl)-4-phenylpyridine;iridium (PubChem CID 140789933) has the molecular formula C27H30IrN- and a molecular weight of 560.76 g/mol. Its IUPAC name is 2-(5,5,6,7,8,8-hexamethyl-6,7-dihydro-3H-naphthalen-3-id-2-yl)-4-phenylpyridine;iridium.
| Compound Name | 2-(5,5,6,7,8,8-hexamethyl-6,7-dihydro-3H-naphthalen-3-id-2-yl)-4-phenylpyridine;iridium |
|---|---|
| PubChem CID | 140789933 |
| Molecular Formula | C27H30IrN- |
| Molecular Weight | 560.76 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | 2-(5,5,6,7,8,8-hexamethyl-6,7-dihydro-3H-naphthalen-3-id-2-yl)-4-phenylpyridine;iridium |
| SMILES | CC1C(C)C(C)(C)c2cc(-c3cc(-c4ccccc4)ccn3)[c-]cc2C1(C)C.[Ir] |
| InChI | InChI=1S/C27H30N.Ir/c1-18-19(2)27(5,6)24-16-22(12-13-23(24)26(18,3)4)25-17-21(14-15-28-25)20-10-8-7-9-11-20;/h7-11,13-19H,1-6H3;/q-1; |
| InChIKey | CTGMPYUGRNMEBG-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.76 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|