C43H34IrN2O-2 — CID 154600559
CID 154600559 (PubChem CID 154600559) has the molecular formula C43H34IrN2O-2 and a molecular weight of 786.97 g/mol.
| Compound Name | CID 154600559 |
|---|---|
| PubChem CID | 154600559 |
| Molecular Formula | C43H34IrN2O-2 |
| Molecular Weight | 786.97 g/mol |
| Exact Mass | 787.23 |
| IUPAC Name | — |
| SMILES | Cc1ccc(-c2[c-]cccc2)nc1.Cc1cnc(-c2[c-]ccc3oc4cc5c6c(c7c(c5cc4c23)C=CCC7)CCC=C6)cc1C.[Ir] |
| InChI | InChI=1S/C31H24NO.C12H10N.Ir/c1-18-14-28(32-17-19(18)2)24-12-7-13-29-31(24)27-15-25-22-10-5-3-8-20(22)21-9-4-6-11-23(21)26(25)16-30(27)33-29;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h5-7,10-11,13-17H,3-4,8-9H2,1-2H3;2-5,7-9H,1H3;/q2*-1; |
| InChIKey | OUQZOQUCLJNFMG-UHFFFAOYSA-N |
| XLogP | 10.99 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.97 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|