C19H26F2N2O — CID 154601811
3-[4-[(2E,4E)-5-fluoro-1-(4-fluorophenyl)-2-methylpenta-2,4-dienyl]piperazin-1-yl]propan-1-ol (PubChem CID 154601811) has the molecular formula C19H26F2N2O and a molecular weight of 336.43 g/mol. Its IUPAC name is 3-[4-[(2E,4E)-5-fluoro-1-(4-fluorophenyl)-2-methylpenta-2,4-dienyl]piperazin-1-yl]propan-1-ol.
| Compound Name | 3-[4-[(2E,4E)-5-fluoro-1-(4-fluorophenyl)-2-methylpenta-2,4-dienyl]piperazin-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 154601811 |
| Molecular Formula | C19H26F2N2O |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 3-[4-[(2E,4E)-5-fluoro-1-(4-fluorophenyl)-2-methylpenta-2,4-dienyl]piperazin-1-yl]propan-1-ol |
| SMILES | C/C(=C\C=C\F)C(c1ccc(F)cc1)N1CCN(CCCO)CC1 |
| InChI | InChI=1S/C19H26F2N2O/c1-16(4-2-9-20)19(17-5-7-18(21)8-6-17)23-13-11-22(12-14-23)10-3-15-24/h2,4-9,19,24H,3,10-15H2,1H3/b9-2+,16-4+ |
| InChIKey | UIXQWMXLYAQKEO-VCUIURRGSA-N |
| XLogP | 3.30 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|