C15H20F3NO4S — CID 154608833
[(2S)-4-[5-ethyl-2-[(2,2,2-trifluoroacetyl)amino]phenyl]butan-2-yl] methanesulfonate (PubChem CID 154608833) has the molecular formula C15H20F3NO4S and a molecular weight of 367.39 g/mol. Its IUPAC name is [(2S)-4-[5-ethyl-2-[(2,2,2-trifluoroacetyl)amino]phenyl]butan-2-yl] methanesulfonate.
| Compound Name | [(2S)-4-[5-ethyl-2-[(2,2,2-trifluoroacetyl)amino]phenyl]butan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 154608833 |
| Molecular Formula | C15H20F3NO4S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | [(2S)-4-[5-ethyl-2-[(2,2,2-trifluoroacetyl)amino]phenyl]butan-2-yl] methanesulfonate |
| SMILES | CCc1ccc(NC(=O)C(F)(F)F)c(CC[C@H](C)OS(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H20F3NO4S/c1-4-11-6-8-13(19-14(20)15(16,17)18)12(9-11)7-5-10(2)23-24(3,21)22/h6,8-10H,4-5,7H2,1-3H3,(H,19,20)/t10-/m0/s1 |
| InChIKey | ALWAMDLHIANGCP-JTQLQIEISA-N |
| XLogP | 3.05 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|