C14H18F3NO2 — CID 154608807
N-[4-ethyl-2-(3-hydroxybutyl)phenyl]-2,2,2-trifluoroacetamide (PubChem CID 154608807) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is N-[4-ethyl-2-(3-hydroxybutyl)phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-ethyl-2-(3-hydroxybutyl)phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 154608807 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-[4-ethyl-2-(3-hydroxybutyl)phenyl]-2,2,2-trifluoroacetamide |
| SMILES | CCc1ccc(NC(=O)C(F)(F)F)c(CCC(C)O)c1 |
| InChI | InChI=1S/C14H18F3NO2/c1-3-10-5-7-12(18-13(20)14(15,16)17)11(8-10)6-4-9(2)19/h5,7-9,19H,3-4,6H2,1-2H3,(H,18,20) |
| InChIKey | GRWORCVSEJTXCA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |