C24H29NO5S — CID 154608852
[5-[(2,6-diethyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-2-(oxiran-2-yl)phenyl]methyl acetate (PubChem CID 154608852) has the molecular formula C24H29NO5S and a molecular weight of 443.57 g/mol. Its IUPAC name is [5-[(2,6-diethyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-2-(oxiran-2-yl)phenyl]methyl acetate.
| Compound Name | [5-[(2,6-diethyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-2-(oxiran-2-yl)phenyl]methyl acetate |
|---|---|
| PubChem CID | 154608852 |
| Molecular Formula | C24H29NO5S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | [5-[(2,6-diethyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-2-(oxiran-2-yl)phenyl]methyl acetate |
| SMILES | CCc1ccc2c(c1)CCC(CC)N2S(=O)(=O)c1ccc(C2CO2)c(COC(C)=O)c1 |
| InChI | InChI=1S/C24H29NO5S/c1-4-17-6-11-23-18(12-17)7-8-20(5-2)25(23)31(27,28)21-9-10-22(24-15-30-24)19(13-21)14-29-16(3)26/h6,9-13,20,24H,4-5,7-8,14-15H2,1-3H3 |
| InChIKey | KEEMRBAGQRADRE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 76.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|