C25H27NO5S — CID 175141793
2-but-2-ynoxy-5-[(2-cyclopropyl-6-ethyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]benzoic acid (PubChem CID 175141793) has the molecular formula C25H27NO5S and a molecular weight of 453.56 g/mol. Its IUPAC name is 2-but-2-ynoxy-5-[(2-cyclopropyl-6-ethyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]benzoic acid.
| Compound Name | 2-but-2-ynoxy-5-[(2-cyclopropyl-6-ethyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]benzoic acid |
|---|---|
| PubChem CID | 175141793 |
| Molecular Formula | C25H27NO5S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 2-but-2-ynoxy-5-[(2-cyclopropyl-6-ethyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]benzoic acid |
| SMILES | CC#CCOc1ccc(S(=O)(=O)N2c3ccc(CC)cc3CCC2C2CC2)cc1C(=O)O |
| InChI | InChI=1S/C25H27NO5S/c1-3-5-14-31-24-13-10-20(16-21(24)25(27)28)32(29,30)26-22(18-7-8-18)12-9-19-15-17(4-2)6-11-23(19)26/h6,10-11,13,15-16,18,22H,4,7-9,12,14H2,1-2H3,(H,27,28) |
| InChIKey | HAUWEMNJUZHGMT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|