C20H22N2O3S — CID 154608822
4-[(2,6-diethyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-2-isocyanophenol (PubChem CID 154608822) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is 4-[(2,6-diethyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-2-isocyanophenol.
| Compound Name | 4-[(2,6-diethyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-2-isocyanophenol |
|---|---|
| PubChem CID | 154608822 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 4-[(2,6-diethyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-2-isocyanophenol |
| SMILES | [C-]#[N+]c1cc(S(=O)(=O)N2c3ccc(CC)cc3CCC2CC)ccc1O |
| InChI | InChI=1S/C20H22N2O3S/c1-4-14-6-10-19-15(12-14)7-8-16(5-2)22(19)26(24,25)17-9-11-20(23)18(13-17)21-3/h6,9-13,16,23H,4-5,7-8H2,1-2H3 |
| InChIKey | AISBMUKFFRKOCY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 61.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|