About 4-acetyl-2-iodophenolate
4-acetyl-2-iodophenolate (PubChem CID 154609369) has the molecular formula C8H6IO2-
and a molecular weight of 261.04 g/mol. Its IUPAC name is 4-acetyl-2-iodophenolate.
Molecular Properties
| Compound Name | 4-acetyl-2-iodophenolate |
| PubChem CID | 154609369 |
| Molecular Formula | C8H6IO2- |
| Molecular Weight | 261.04 g/mol |
| Exact Mass | 260.94 |
| IUPAC Name | 4-acetyl-2-iodophenolate |
| SMILES | CC(=O)c1ccc([O-])c(I)c1 |
| InChI | InChI=1S/C8H7IO2/c1-5(10)6-2-3-8(11)7(9)4-6/h2-4,11H,1H3/p-1 |
| InChIKey | SJRAJHOOMLHHQN-UHFFFAOYSA-M |
| XLogP | 1.57 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.04 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-acetyl-2-iodophenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-2-iodophenolate?
The IUPAC name of 4-acetyl-2-iodophenolate (CID 154609369) is 4-acetyl-2-iodophenolate.
What is the SMILES notation for 4-acetyl-2-iodophenolate?
The canonical SMILES for 4-acetyl-2-iodophenolate is CC(=O)c1ccc([O-])c(I)c1.
What is the InChIKey of 4-acetyl-2-iodophenolate?
The InChIKey is SJRAJHOOMLHHQN-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H7IO2/c1-5(10)6-2-3-8(11)7(9)4-6/h2-4,11H,1H3/p-1.
What are the key properties of 4-acetyl-2-iodophenolate?
4-acetyl-2-iodophenolate has a molecular weight of 261.04 g/mol, XLogP of 1.57, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-2-iodophenolate is sourced from PubChem (CID 154609369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).