About sodium 3-acetylphenolate
sodium 3-acetylphenolate (PubChem CID 23687390) has the molecular formula C8H7NaO2
and a molecular weight of 158.13 g/mol. Its IUPAC name is sodium 3-acetylphenolate.
Molecular Properties
| Compound Name | sodium 3-acetylphenolate |
| PubChem CID | 23687390 |
| Molecular Formula | C8H7NaO2 |
| Molecular Weight | 158.13 g/mol |
| Exact Mass | 158.03 |
| IUPAC Name | sodium 3-acetylphenolate |
| SMILES | CC(=O)c1cccc([O-])c1.[Na+] |
| InChI | InChI=1S/C8H8O2.Na/c1-6(9)7-3-2-4-8(10)5-7;/h2-5,10H,1H3;/q;+1/p-1 |
| InChIKey | HLWRIVITPPTPEV-UHFFFAOYSA-M |
| XLogP | -2.03 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.13 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium 3-acetylphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-acetylphenolate?
The IUPAC name of sodium 3-acetylphenolate (CID 23687390) is sodium 3-acetylphenolate.
What is the SMILES notation for sodium 3-acetylphenolate?
The canonical SMILES for sodium 3-acetylphenolate is CC(=O)c1cccc([O-])c1.[Na+].
What is the InChIKey of sodium 3-acetylphenolate?
The InChIKey is HLWRIVITPPTPEV-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H8O2.Na/c1-6(9)7-3-2-4-8(10)5-7;/h2-5,10H,1H3;/q;+1/p-1.
What are the key properties of sodium 3-acetylphenolate?
sodium 3-acetylphenolate has a molecular weight of 158.13 g/mol, XLogP of -2.03, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-acetylphenolate is sourced from PubChem (CID 23687390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).