C28H27F6IrN2O2- — CID 154612367
1,1,1,3,3,3-hexafluoro-2-pyridin-2-ylpropan-2-ol;iridium;2-[(E)-[6-(2-methylpentan-3-yl)-3H-1-benzofuran-3-id-2-ylidene]methyl]pyridine (PubChem CID 154612367) has the molecular formula C28H27F6IrN2O2- and a molecular weight of 729.74 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-pyridin-2-ylpropan-2-ol;iridium;2-[(E)-[6-(2-methylpentan-3-yl)-3H-1-benzofuran-3-id-2-ylidene]methyl]pyridine.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-pyridin-2-ylpropan-2-ol;iridium;2-[(E)-[6-(2-methylpentan-3-yl)-3H-1-benzofuran-3-id-2-ylidene]methyl]pyridine |
|---|---|
| PubChem CID | 154612367 |
| Molecular Formula | C28H27F6IrN2O2- |
| Molecular Weight | 729.74 g/mol |
| Exact Mass | 730.16 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-pyridin-2-ylpropan-2-ol;iridium;2-[(E)-[6-(2-methylpentan-3-yl)-3H-1-benzofuran-3-id-2-ylidene]methyl]pyridine |
| SMILES | CCC(c1ccc2c(c1)O/C(=C/c1ccccn1)[CH-]2)C(C)C.OC(c1ccccn1)(C(F)(F)F)C(F)(F)F.[Ir] |
| InChI | InChI=1S/C20H22NO.C8H5F6NO.Ir/c1-4-19(14(2)3)15-8-9-16-11-18(22-20(16)12-15)13-17-7-5-6-10-21-17;9-7(10,11)6(16,8(12,13)14)5-3-1-2-4-15-5;/h5-14,19H,4H2,1-3H3;1-4,16H;/q-1;;/b18-13+;; |
| InChIKey | OQFYCTAEYFSQJX-YWABOPJLSA-N |
| XLogP | 7.61 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.74 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|