C16H23N3O — CID 154612475
2-butyl-1-pyrazolo[1,5-a]pyrimidin-3-ylhexan-1-one (PubChem CID 154612475) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 2-butyl-1-pyrazolo[1,5-a]pyrimidin-3-ylhexan-1-one.
| Compound Name | 2-butyl-1-pyrazolo[1,5-a]pyrimidin-3-ylhexan-1-one |
|---|---|
| PubChem CID | 154612475 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 2-butyl-1-pyrazolo[1,5-a]pyrimidin-3-ylhexan-1-one |
| SMILES | CCCCC(CCCC)C(=O)c1cnn2cccnc12 |
| InChI | InChI=1S/C16H23N3O/c1-3-5-8-13(9-6-4-2)15(20)14-12-18-19-11-7-10-17-16(14)19/h7,10-13H,3-6,8-9H2,1-2H3 |
| InChIKey | HNXFCJVEFQLKBV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |