C14H15F2N3O4 — CID 154613403
[2-(2,6-difluoro-4-methoxyphenyl)-2-oxoethyl] (E)-3-amino-2-carbamimidoylbut-2-enoate (PubChem CID 154613403) has the molecular formula C14H15F2N3O4 and a molecular weight of 327.29 g/mol. Its IUPAC name is [2-(2,6-difluoro-4-methoxyphenyl)-2-oxoethyl] (E)-3-amino-2-carbamimidoylbut-2-enoate.
| Compound Name | [2-(2,6-difluoro-4-methoxyphenyl)-2-oxoethyl] (E)-3-amino-2-carbamimidoylbut-2-enoate |
|---|---|
| PubChem CID | 154613403 |
| Molecular Formula | C14H15F2N3O4 |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | [2-(2,6-difluoro-4-methoxyphenyl)-2-oxoethyl] (E)-3-amino-2-carbamimidoylbut-2-enoate |
| SMILES | [H]/N=C(N)/C(C(=O)OCC(=O)c1c(F)cc(OC)cc1F)=C(/C)N |
| InChI | InChI=1S/C14H15F2N3O4/c1-6(17)11(13(18)19)14(21)23-5-10(20)12-8(15)3-7(22-2)4-9(12)16/h3-4H,5,17H2,1-2H3,(H3,18,19)/b11-6+ |
| InChIKey | IWTYKNZDAYJUJO-IZZDOVSWSA-N |
| XLogP | 0.87 |
| TPSA | 128.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|