C15H18FN3O4 — CID 154613439
[2-(2-fluoro-4-methoxyphenyl)-2-oxoethyl] (E)-3-amino-2-carbamimidoylpent-2-enoate (PubChem CID 154613439) has the molecular formula C15H18FN3O4 and a molecular weight of 323.32 g/mol. Its IUPAC name is [2-(2-fluoro-4-methoxyphenyl)-2-oxoethyl] (E)-3-amino-2-carbamimidoylpent-2-enoate.
| Compound Name | [2-(2-fluoro-4-methoxyphenyl)-2-oxoethyl] (E)-3-amino-2-carbamimidoylpent-2-enoate |
|---|---|
| PubChem CID | 154613439 |
| Molecular Formula | C15H18FN3O4 |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | [2-(2-fluoro-4-methoxyphenyl)-2-oxoethyl] (E)-3-amino-2-carbamimidoylpent-2-enoate |
| SMILES | [H]/N=C(N)/C(C(=O)OCC(=O)c1ccc(OC)cc1F)=C(\N)CC |
| InChI | InChI=1S/C15H18FN3O4/c1-3-11(17)13(14(18)19)15(21)23-7-12(20)9-5-4-8(22-2)6-10(9)16/h4-6H,3,7,17H2,1-2H3,(H3,18,19)/b13-11+ |
| InChIKey | AMXWTNLVZYIUOC-ACCUITESSA-N |
| XLogP | 1.12 |
| TPSA | 128.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|