C24H23N2O+ — CID 154616164
4-(1,1-dideuterio-2-methylpropyl)-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-1-carbonitrile (PubChem CID 154616164) has the molecular formula C24H23N2O+ and a molecular weight of 357.47 g/mol. Its IUPAC name is 4-(1,1-dideuterio-2-methylpropyl)-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-1-carbonitrile.
| Compound Name | 4-(1,1-dideuterio-2-methylpropyl)-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-1-carbonitrile |
|---|---|
| PubChem CID | 154616164 |
| Molecular Formula | C24H23N2O+ |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 4-(1,1-dideuterio-2-methylpropyl)-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-1-carbonitrile |
| SMILES | [2H]C([2H])(c1ccc(C#N)c2c1oc1c(-c3cccc[n+]3C)c(C)ccc12)C(C)C |
| InChI | InChI=1S/C24H23N2O/c1-15(2)13-17-9-10-18(14-25)22-19-11-8-16(3)21(24(19)27-23(17)22)20-7-5-6-12-26(20)4/h5-12,15H,13H2,1-4H3/q+1/i13D2 |
| InChIKey | NPDNKZXEQUKYBJ-KLTYLHELSA-N |
| XLogP | 5.46 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|