C27H29N2O+ — CID 170253885
7-methyl-9-(2-methylpropyl)-6-(1-methylpyridin-1-ium-2-yl)-4-propan-2-yldibenzofuran-3-carbonitrile (PubChem CID 170253885) has the molecular formula C27H29N2O+ and a molecular weight of 397.54 g/mol. Its IUPAC name is 7-methyl-9-(2-methylpropyl)-6-(1-methylpyridin-1-ium-2-yl)-4-propan-2-yldibenzofuran-3-carbonitrile.
| Compound Name | 7-methyl-9-(2-methylpropyl)-6-(1-methylpyridin-1-ium-2-yl)-4-propan-2-yldibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 170253885 |
| Molecular Formula | C27H29N2O+ |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 7-methyl-9-(2-methylpropyl)-6-(1-methylpyridin-1-ium-2-yl)-4-propan-2-yldibenzofuran-3-carbonitrile |
| SMILES | Cc1cc(CC(C)C)c2c(oc3c(C(C)C)c(C#N)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C27H29N2O/c1-16(2)13-20-14-18(5)24(22-9-7-8-12-29(22)6)27-25(20)21-11-10-19(15-28)23(17(3)4)26(21)30-27/h7-12,14,16-17H,13H2,1-6H3/q+1 |
| InChIKey | BEZXEXWFMSIGTQ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|