C28H33N3O — CID 15461956
N-[2-[(3R)-3-naphthalen-2-ylpyrrolidin-1-yl]ethyl]-N-pyridin-2-ylcyclohexanecarboxamide (PubChem CID 15461956) has the molecular formula C28H33N3O and a molecular weight of 427.59 g/mol. Its IUPAC name is N-[2-[(3R)-3-naphthalen-2-ylpyrrolidin-1-yl]ethyl]-N-pyridin-2-ylcyclohexanecarboxamide.
| Compound Name | N-[2-[(3R)-3-naphthalen-2-ylpyrrolidin-1-yl]ethyl]-N-pyridin-2-ylcyclohexanecarboxamide |
|---|---|
| PubChem CID | 15461956 |
| Molecular Formula | C28H33N3O |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | N-[2-[(3R)-3-naphthalen-2-ylpyrrolidin-1-yl]ethyl]-N-pyridin-2-ylcyclohexanecarboxamide |
| SMILES | O=C(C1CCCCC1)N(CCN1CC[C@H](c2ccc3ccccc3c2)C1)c1ccccn1 |
| InChI | InChI=1S/C28H33N3O/c32-28(23-9-2-1-3-10-23)31(27-12-6-7-16-29-27)19-18-30-17-15-26(21-30)25-14-13-22-8-4-5-11-24(22)20-25/h4-8,11-14,16,20,23,26H,1-3,9-10,15,17-19,21H2/t26-/m0/s1 |
| InChIKey | XGGYIXAOWMWDIW-SANMLTNESA-N |
| XLogP | 5.64 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |