C25H35BrN4OSi — CID 154620168
2-[[7-bromo-2-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]benzimidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 154620168) has the molecular formula C25H35BrN4OSi and a molecular weight of 515.57 g/mol. Its IUPAC name is 2-[[7-bromo-2-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]benzimidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[7-bromo-2-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]benzimidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 154620168 |
| Molecular Formula | C25H35BrN4OSi |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | 2-[[7-bromo-2-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]benzimidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1cccnc1[C@@H]1CCC[C@H](c2nc3cccc(Br)c3n2COCC[Si](C)(C)C)N1C |
| InChI | InChI=1S/C25H35BrN4OSi/c1-18-9-8-14-27-23(18)21-12-7-13-22(29(21)2)25-28-20-11-6-10-19(26)24(20)30(25)17-31-15-16-32(3,4)5/h6,8-11,14,21-22H,7,12-13,15-17H2,1-5H3/t21-,22+/m0/s1 |
| InChIKey | PNLGEVPOYIXXLH-FCHUYYIVSA-N |
| XLogP | 6.71 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|