C48H41AuNO2P — CID 154620925
2-(4-tert-butylbenzene-6-id-1-yl)-4-(4-diphenylphosphorylphenyl)-6-(4-methoxybenzene-6-id-1-yl)pyridine;ethenylbenzene;gold(3+) (PubChem CID 154620925) has the molecular formula C48H41AuNO2P and a molecular weight of 891.80 g/mol. Its IUPAC name is 2-(4-tert-butylbenzene-6-id-1-yl)-4-(4-diphenylphosphorylphenyl)-6-(4-methoxybenzene-6-id-1-yl)pyridine;ethenylbenzene;gold(3+).
| Compound Name | 2-(4-tert-butylbenzene-6-id-1-yl)-4-(4-diphenylphosphorylphenyl)-6-(4-methoxybenzene-6-id-1-yl)pyridine;ethenylbenzene;gold(3+) |
|---|---|
| PubChem CID | 154620925 |
| Molecular Formula | C48H41AuNO2P |
| Molecular Weight | 891.80 g/mol |
| Exact Mass | 891.25 |
| IUPAC Name | 2-(4-tert-butylbenzene-6-id-1-yl)-4-(4-diphenylphosphorylphenyl)-6-(4-methoxybenzene-6-id-1-yl)pyridine;ethenylbenzene;gold(3+) |
| SMILES | COc1c[c-]c(-c2cc(-c3ccc(P(=O)(c4ccccc4)c4ccccc4)cc3)cc(-c3[c-]cc(C(C)(C)C)cc3)n2)cc1.[Au+3].[H]/[C-]=C\c1ccccc1 |
| InChI | InChI=1S/C40H34NO2P.C8H7.Au/c1-40(2,3)33-21-15-30(16-22-33)38-27-32(28-39(41-38)31-17-23-34(43-4)24-18-31)29-19-25-37(26-20-29)44(42,35-11-7-5-8-12-35)36-13-9-6-10-14-36;1-2-8-6-4-3-5-7-8;/h5-15,17,19-28H,1-4H3;1-7H;/q-2;-1;+3 |
| InChIKey | IAFCMOPMWIDDFU-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.80 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|