C63H52AuF6N2OP — CID 154620911
4-[4-bis[4-(trifluoromethyl)phenyl]phosphorylphenyl]-2,6-bis(4-tert-butylbenzene-6-id-1-yl)pyridine;N,N-diphenylaniline;gold(3+) (PubChem CID 154620911) has the molecular formula C63H52AuF6N2OP and a molecular weight of 1195.05 g/mol. Its IUPAC name is 4-[4-bis[4-(trifluoromethyl)phenyl]phosphorylphenyl]-2,6-bis(4-tert-butylbenzene-6-id-1-yl)pyridine;N,N-diphenylaniline;gold(3+).
| Compound Name | 4-[4-bis[4-(trifluoromethyl)phenyl]phosphorylphenyl]-2,6-bis(4-tert-butylbenzene-6-id-1-yl)pyridine;N,N-diphenylaniline;gold(3+) |
|---|---|
| PubChem CID | 154620911 |
| Molecular Formula | C63H52AuF6N2OP |
| Molecular Weight | 1195.05 g/mol |
| Exact Mass | 1194.34 |
| IUPAC Name | 4-[4-bis[4-(trifluoromethyl)phenyl]phosphorylphenyl]-2,6-bis(4-tert-butylbenzene-6-id-1-yl)pyridine;N,N-diphenylaniline;gold(3+) |
| SMILES | CC(C)(C)c1c[c-]c(-c2cc(-c3ccc(P(=O)(c4ccc(C(F)(F)F)cc4)c4ccc(C(F)(F)F)cc4)cc3)cc(-c3[c-]cc(C(C)(C)C)cc3)n2)cc1.[Au+3].[c-]1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C45H38F6NOP.C18H14N.Au/c1-42(2,3)33-13-7-30(8-14-33)40-27-32(28-41(52-40)31-9-15-34(16-10-31)43(4,5)6)29-11-21-37(22-12-29)54(53,38-23-17-35(18-24-38)44(46,47)48)39-25-19-36(20-26-39)45(49,50)51;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h7,9,11-28H,1-6H3;1-2,4-15H;/q-2;-1;+3 |
| InChIKey | OCNDIAVHSBBPNK-UHFFFAOYSA-N |
| XLogP | 16.91 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1195.05 |
| LogP ≤ 5 | 16.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|