C57H52AuN2OP — CID 154620940
2,6-bis(4-tert-butylbenzene-6-id-1-yl)-4-[(E)-2-diphenylphosphorylethenyl]pyridine;N,N-diphenylaniline;gold(3+) (PubChem CID 154620940) has the molecular formula C57H52AuN2OP and a molecular weight of 1009.00 g/mol. Its IUPAC name is 2,6-bis(4-tert-butylbenzene-6-id-1-yl)-4-[(E)-2-diphenylphosphorylethenyl]pyridine;N,N-diphenylaniline;gold(3+).
| Compound Name | 2,6-bis(4-tert-butylbenzene-6-id-1-yl)-4-[(E)-2-diphenylphosphorylethenyl]pyridine;N,N-diphenylaniline;gold(3+) |
|---|---|
| PubChem CID | 154620940 |
| Molecular Formula | C57H52AuN2OP |
| Molecular Weight | 1009.00 g/mol |
| Exact Mass | 1008.35 |
| IUPAC Name | 2,6-bis(4-tert-butylbenzene-6-id-1-yl)-4-[(E)-2-diphenylphosphorylethenyl]pyridine;N,N-diphenylaniline;gold(3+) |
| SMILES | CC(C)(C)c1c[c-]c(-c2cc(/C=C/P(=O)(c3ccccc3)c3ccccc3)cc(-c3[c-]cc(C(C)(C)C)cc3)n2)cc1.[Au+3].[c-]1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C39H38NOP.C18H14N.Au/c1-38(2,3)32-21-17-30(18-22-32)36-27-29(28-37(40-36)31-19-23-33(24-20-31)39(4,5)6)25-26-42(41,34-13-9-7-10-14-34)35-15-11-8-12-16-35;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h7-17,19,21-28H,1-6H3;1-2,4-15H;/q-2;-1;+3/b26-25+;; |
| InChIKey | ZBBWXHXKYIQCQZ-LHPVOXLHSA-N |
| XLogP | 14.55 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1009.00 |
| LogP ≤ 5 | 14.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|