C24H19NY-2 — CID 59973487
benzene;N,N-diphenylaniline;yttrium (PubChem CID 59973487) has the molecular formula C24H19NY-2 and a molecular weight of 410.33 g/mol. Its IUPAC name is benzene;N,N-diphenylaniline;yttrium.
| Compound Name | benzene;N,N-diphenylaniline;yttrium |
|---|---|
| PubChem CID | 59973487 |
| Molecular Formula | C24H19NY-2 |
| Molecular Weight | 410.33 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | benzene;N,N-diphenylaniline;yttrium |
| SMILES | [Y].[c-]1ccc(N(c2ccccc2)c2ccccc2)cc1.[c-]1ccccc1 |
| InChI | InChI=1S/C18H14N.C6H5.Y/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-4-6-5-3-1;/h1-2,4-15H;1-5H;/q2*-1; |
| InChIKey | GVFRKNZMFAQPCA-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.33 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|