C18H23NO2 — CID 154621932
2,2-dimethyl-N-(9-oxo-4b,5,6,7,8,8a-hexahydrofluoren-2-yl)propanamide (PubChem CID 154621932) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 2,2-dimethyl-N-(9-oxo-4b,5,6,7,8,8a-hexahydrofluoren-2-yl)propanamide.
| Compound Name | 2,2-dimethyl-N-(9-oxo-4b,5,6,7,8,8a-hexahydrofluoren-2-yl)propanamide |
|---|---|
| PubChem CID | 154621932 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 2,2-dimethyl-N-(9-oxo-4b,5,6,7,8,8a-hexahydrofluoren-2-yl)propanamide |
| SMILES | CC(C)(C)C(=O)Nc1ccc2c(c1)C(=O)C1CCCCC21 |
| InChI | InChI=1S/C18H23NO2/c1-18(2,3)17(21)19-11-8-9-13-12-6-4-5-7-14(12)16(20)15(13)10-11/h8-10,12,14H,4-7H2,1-3H3,(H,19,21) |
| InChIKey | XUHKLSVZBBYUND-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |