C11H14N3+ — CID 154623196
[amino-(cyclopenta-1,3-dien-1-ylamino)methylidene]-cyclopenta-1,3-dien-1-ylazanium (PubChem CID 154623196) has the molecular formula C11H14N3+ and a molecular weight of 188.25 g/mol. Its IUPAC name is [amino-(cyclopenta-1,3-dien-1-ylamino)methylidene]-cyclopenta-1,3-dien-1-ylazanium.
| Compound Name | [amino-(cyclopenta-1,3-dien-1-ylamino)methylidene]-cyclopenta-1,3-dien-1-ylazanium |
|---|---|
| PubChem CID | 154623196 |
| Molecular Formula | C11H14N3+ |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | [amino-(cyclopenta-1,3-dien-1-ylamino)methylidene]-cyclopenta-1,3-dien-1-ylazanium |
| SMILES | N/C(NC1=CC=CC1)=[NH+]\C1=CC=CC1 |
| InChI | InChI=1S/C11H13N3/c12-11(13-9-5-1-2-6-9)14-10-7-3-4-8-10/h1-5,7H,6,8H2,(H3,12,13,14)/p+1 |
| InChIKey | KGBVYWXYZQCAGE-UHFFFAOYSA-O |
| XLogP | -0.34 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|