C11H13N2+ — CID 164793032
cyclopenta-1,3-dien-1-yl-[(cyclopenta-1,3-dien-1-ylamino)methylidene]azanium (PubChem CID 164793032) has the molecular formula C11H13N2+ and a molecular weight of 173.24 g/mol. Its IUPAC name is cyclopenta-1,3-dien-1-yl-[(cyclopenta-1,3-dien-1-ylamino)methylidene]azanium.
| Compound Name | cyclopenta-1,3-dien-1-yl-[(cyclopenta-1,3-dien-1-ylamino)methylidene]azanium |
|---|---|
| PubChem CID | 164793032 |
| Molecular Formula | C11H13N2+ |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | cyclopenta-1,3-dien-1-yl-[(cyclopenta-1,3-dien-1-ylamino)methylidene]azanium |
| SMILES | C1=CCC(N/C=[NH+]/C2=CC=CC2)=C1 |
| InChI | InChI=1S/C11H12N2/c1-2-6-10(5-1)12-9-13-11-7-3-4-8-11/h1-5,7,9H,6,8H2,(H,12,13)/p+1 |
| InChIKey | OIKQJHNFLJQKGE-UHFFFAOYSA-O |
| XLogP | 0.37 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|