4,5-bis(prop-2-enyl)-1H-imidazol-1-ium chloride

C9H13ClN2 — CID 140633020

IUPAC4,5-bis(prop-2-enyl)-1H-imidazol-1-ium chloride
SMILESC=CCC1=C(CC=C)[NH2+]C=N1.[Cl-]
InChIInChI=1S/C9H12N2.ClH/c1-3-5-8-9(6-4-2)11-7-10-8;/h3-4,7H,1-2,5-6H2,(H,10,11);1H
InChIKeyKROPIKLHXDIOED-UHFFFAOYSA-N
MW184.67 g/mol
LogP-2.04
Rot. Bonds4

About 4,5-bis(prop-2-enyl)-1H-imidazol-1-ium chloride

4,5-bis(prop-2-enyl)-1H-imidazol-1-ium chloride (PubChem CID 140633020) has the molecular formula C9H13ClN2 and a molecular weight of 184.67 g/mol. Its IUPAC name is 4,5-bis(prop-2-enyl)-1H-imidazol-1-ium chloride.

Molecular Properties

Compound Name4,5-bis(prop-2-enyl)-1H-imidazol-1-ium chloride
PubChem CID140633020
Molecular FormulaC9H13ClN2
Molecular Weight184.67 g/mol
Exact Mass184.08
IUPAC Name4,5-bis(prop-2-enyl)-1H-imidazol-1-ium chloride
SMILESC=CCC1=C(CC=C)[NH2+]C=N1.[Cl-]
InChIInChI=1S/C9H12N2.ClH/c1-3-5-8-9(6-4-2)11-7-10-8;/h3-4,7H,1-2,5-6H2,(H,10,11);1H
InChIKeyKROPIKLHXDIOED-UHFFFAOYSA-N
XLogP-2.04
TPSA28.97 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.67
LogP ≤ 5-2.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 4,5-bis(prop-2-enyl)-1H-imidazol-1-ium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,5-bis(prop-2-enyl)-1H-imidazol-1-ium chloride?
The IUPAC name of 4,5-bis(prop-2-enyl)-1H-imidazol-1-ium chloride (CID 140633020) is 4,5-bis(prop-2-enyl)-1H-imidazol-1-ium chloride.
What is the SMILES notation for 4,5-bis(prop-2-enyl)-1H-imidazol-1-ium chloride?
The canonical SMILES for 4,5-bis(prop-2-enyl)-1H-imidazol-1-ium chloride is C=CCC1=C(CC=C)[NH2+]C=N1.[Cl-].
What is the InChIKey of 4,5-bis(prop-2-enyl)-1H-imidazol-1-ium chloride?
The InChIKey is KROPIKLHXDIOED-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2.ClH/c1-3-5-8-9(6-4-2)11-7-10-8;/h3-4,7H,1-2,5-6H2,(H,10,11);1H.
What are the key properties of 4,5-bis(prop-2-enyl)-1H-imidazol-1-ium chloride?
4,5-bis(prop-2-enyl)-1H-imidazol-1-ium chloride has a molecular weight of 184.67 g/mol, XLogP of -2.04, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(prop-2-enyl)-1H-imidazol-1-ium chloride is sourced from PubChem (CID 140633020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).