C9H13ClN2 — CID 140633020
4,5-bis(prop-2-enyl)-1H-imidazol-1-ium chloride (PubChem CID 140633020) has the molecular formula C9H13ClN2 and a molecular weight of 184.67 g/mol. Its IUPAC name is 4,5-bis(prop-2-enyl)-1H-imidazol-1-ium chloride.
| Compound Name | 4,5-bis(prop-2-enyl)-1H-imidazol-1-ium chloride |
|---|---|
| PubChem CID | 140633020 |
| Molecular Formula | C9H13ClN2 |
| Molecular Weight | 184.67 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 4,5-bis(prop-2-enyl)-1H-imidazol-1-ium chloride |
| SMILES | C=CCC1=C(CC=C)[NH2+]C=N1.[Cl-] |
| InChI | InChI=1S/C9H12N2.ClH/c1-3-5-8-9(6-4-2)11-7-10-8;/h3-4,7H,1-2,5-6H2,(H,10,11);1H |
| InChIKey | KROPIKLHXDIOED-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 28.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.67 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|