C11H12N2 — CID 164793033
N,N'-di(cyclopenta-1,3-dien-1-yl)methanimidamide (PubChem CID 164793033) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is N,N'-di(cyclopenta-1,3-dien-1-yl)methanimidamide.
| Compound Name | N,N'-di(cyclopenta-1,3-dien-1-yl)methanimidamide |
|---|---|
| PubChem CID | 164793033 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | N,N'-di(cyclopenta-1,3-dien-1-yl)methanimidamide |
| SMILES | C1=CCC(/N=C/NC2=CC=CC2)=C1 |
| InChI | InChI=1S/C11H12N2/c1-2-6-10(5-1)12-9-13-11-7-3-4-8-11/h1-5,7,9H,6,8H2,(H,12,13) |
| InChIKey | OIKQJHNFLJQKGE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|