C19H26FNO3 — CID 154623415
tert-butyl (2S)-2-[(4-fluorophenoxy)methyl]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 154623415) has the molecular formula C19H26FNO3 and a molecular weight of 335.42 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(4-fluorophenoxy)methyl]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(4-fluorophenoxy)methyl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 154623415 |
| Molecular Formula | C19H26FNO3 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | tert-butyl (2S)-2-[(4-fluorophenoxy)methyl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1[C@@H](COc1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C19H26FNO3/c1-19(2,3)24-18(22)21-15-7-4-13(17(21)11-8-15)12-23-16-9-5-14(20)6-10-16/h5-6,9-10,13,15,17H,4,7-8,11-12H2,1-3H3/t13-,15?,17?/m1/s1 |
| InChIKey | LUNIRPXUMDCNKI-BZOOQXSSSA-N |
| XLogP | 4.38 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |