C20H26FNO4 — CID 70110115
tert-butyl (2S,5S)-2-[(4-fluorophenoxy)methyl]-5-(4-hydroxybut-1-ynyl)pyrrolidine-1-carboxylate (PubChem CID 70110115) has the molecular formula C20H26FNO4 and a molecular weight of 363.43 g/mol. Its IUPAC name is tert-butyl (2S,5S)-2-[(4-fluorophenoxy)methyl]-5-(4-hydroxybut-1-ynyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,5S)-2-[(4-fluorophenoxy)methyl]-5-(4-hydroxybut-1-ynyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 70110115 |
| Molecular Formula | C20H26FNO4 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | tert-butyl (2S,5S)-2-[(4-fluorophenoxy)methyl]-5-(4-hydroxybut-1-ynyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](COc2ccc(F)cc2)CC[C@H]1C#CCCO |
| InChI | InChI=1S/C20H26FNO4/c1-20(2,3)26-19(24)22-16(6-4-5-13-23)9-10-17(22)14-25-18-11-7-15(21)8-12-18/h7-8,11-12,16-17,23H,5,9-10,13-14H2,1-3H3/t16-,17+/m1/s1 |
| InChIKey | GEJGCPMLMAYZGJ-SJORKVTESA-N |
| XLogP | 3.36 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|