C6H12F3O3Rf- — CID 154623566
1-(2,2-difluoroethoxy)butan-2-ol;hypofluorous acid;rutherfordium (PubChem CID 154623566) has the molecular formula C6H12F3O3Rf- and a molecular weight of 456.15 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxy)butan-2-ol;hypofluorous acid;rutherfordium.
| Compound Name | 1-(2,2-difluoroethoxy)butan-2-ol;hypofluorous acid;rutherfordium |
|---|---|
| PubChem CID | 154623566 |
| Molecular Formula | C6H12F3O3Rf- |
| Molecular Weight | 456.15 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 1-(2,2-difluoroethoxy)butan-2-ol;hypofluorous acid;rutherfordium |
| SMILES | CCC(O)COC[C-](F)F.OF.[Rf] |
| InChI | InChI=1S/C6H11F2O2.FHO.Rf/c1-2-5(9)3-10-4-6(7)8;1-2;/h5,9H,2-4H2,1H3;2H;/q-1;; |
| InChIKey | XKOSUHABSHRJOI-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.15 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|