C34H34IrNO3- — CID 154625648
4-(3,5-dimethylbenzene-6-id-1-yl)-9-methylindeno[2,1-f]isoquinolin-11-one;(Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium (PubChem CID 154625648) has the molecular formula C34H34IrNO3- and a molecular weight of 696.87 g/mol. Its IUPAC name is 4-(3,5-dimethylbenzene-6-id-1-yl)-9-methylindeno[2,1-f]isoquinolin-11-one;(Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium.
| Compound Name | 4-(3,5-dimethylbenzene-6-id-1-yl)-9-methylindeno[2,1-f]isoquinolin-11-one;(Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium |
|---|---|
| PubChem CID | 154625648 |
| Molecular Formula | C34H34IrNO3- |
| Molecular Weight | 696.87 g/mol |
| Exact Mass | 697.22 |
| IUPAC Name | 4-(3,5-dimethylbenzene-6-id-1-yl)-9-methylindeno[2,1-f]isoquinolin-11-one;(Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium |
| SMILES | CC(C)C(=O)/C=C(\O)C(C)C.Cc1[c-]c(-c2nccc3c4c(ccc23)-c2ccc(C)cc2C4=O)cc(C)c1.[Ir] |
| InChI | InChI=1S/C25H18NO.C9H16O2.Ir/c1-14-4-5-18-19-6-7-21-20(23(19)25(27)22(18)13-14)8-9-26-24(21)17-11-15(2)10-16(3)12-17;1-6(2)8(10)5-9(11)7(3)4;/h4-11,13H,1-3H3;5-7,10H,1-4H3;/q-1;;/b;8-5-; |
| InChIKey | FWHADBSDOHXBGD-QBBOVCHSSA-N |
| XLogP | 8.15 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.87 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|