C28H13F13N8O — CID 154629692
3,3-bis[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(3-fluoro-4-pyridinyl)prop-2-enamide (PubChem CID 154629692) has the molecular formula C28H13F13N8O and a molecular weight of 724.44 g/mol. Its IUPAC name is 3,3-bis[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(3-fluoro-4-pyridinyl)prop-2-enamide.
| Compound Name | 3,3-bis[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(3-fluoro-4-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 154629692 |
| Molecular Formula | C28H13F13N8O |
| Molecular Weight | 724.44 g/mol |
| Exact Mass | 724.10 |
| IUPAC Name | 3,3-bis[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(3-fluoro-4-pyridinyl)prop-2-enamide |
| SMILES | NC(=O)C(=C(n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1ccncc1F |
| InChI | InChI=1S/C28H13F13N8O/c29-19-9-43-2-1-18(19)20(21(42)50)24(48-10-44-22(46-48)12-3-14(25(30,31)32)7-15(4-12)26(33,34)35)49-11-45-23(47-49)13-5-16(27(36,37)38)8-17(6-13)28(39,40)41/h1-11H,(H2,42,50) |
| InChIKey | BFULIBNUJPJDGG-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 117.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.44 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|