C24H42N4O2 — CID 154630259
1-(6-methylheptyl)-3-[6-(6-methylheptylcarbamoylamino)hexa-2,4-diynyl]urea (PubChem CID 154630259) has the molecular formula C24H42N4O2 and a molecular weight of 418.63 g/mol. Its IUPAC name is 1-(6-methylheptyl)-3-[6-(6-methylheptylcarbamoylamino)hexa-2,4-diynyl]urea.
| Compound Name | 1-(6-methylheptyl)-3-[6-(6-methylheptylcarbamoylamino)hexa-2,4-diynyl]urea |
|---|---|
| PubChem CID | 154630259 |
| Molecular Formula | C24H42N4O2 |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | 1-(6-methylheptyl)-3-[6-(6-methylheptylcarbamoylamino)hexa-2,4-diynyl]urea |
| SMILES | CC(C)CCCCCNC(=O)NCC#CC#CCNC(=O)NCCCCCC(C)C |
| InChI | InChI=1S/C24H42N4O2/c1-21(2)15-9-7-13-19-27-23(29)25-17-11-5-6-12-18-26-24(30)28-20-14-8-10-16-22(3)4/h21-22H,7-10,13-20H2,1-4H3,(H2,25,27,29)(H2,26,28,30) |
| InChIKey | DPVGHIOOJRDLJA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|