About zinc methylsulfanylethane
zinc methylsulfanylethane (PubChem CID 154630711) has the molecular formula C6H14S2Zn
and a molecular weight of 215.70 g/mol. Its IUPAC name is zinc methylsulfanylethane.
Molecular Properties
| Compound Name | zinc methylsulfanylethane |
| PubChem CID | 154630711 |
| Molecular Formula | C6H14S2Zn |
| Molecular Weight | 215.70 g/mol |
| Exact Mass | 213.98 |
| IUPAC Name | zinc methylsulfanylethane |
| SMILES | [CH2-]CSC.[CH2-]CSC.[Zn+2] |
| InChI | InChI=1S/2C3H7S.Zn/c2*1-3-4-2;/h2*1,3H2,2H3;/q2*-1;+2 |
| InChIKey | PFGIEYIPUKBGLK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.70 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc methylsulfanylethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc methylsulfanylethane?
The IUPAC name of zinc methylsulfanylethane (CID 154630711) is zinc methylsulfanylethane.
What is the SMILES notation for zinc methylsulfanylethane?
The canonical SMILES for zinc methylsulfanylethane is [CH2-]CSC.[CH2-]CSC.[Zn+2].
What is the InChIKey of zinc methylsulfanylethane?
The InChIKey is PFGIEYIPUKBGLK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H7S.Zn/c2*1-3-4-2;/h2*1,3H2,2H3;/q2*-1;+2.
What are the key properties of zinc methylsulfanylethane?
zinc methylsulfanylethane has a molecular weight of 215.70 g/mol, XLogP of 2.36, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for zinc methylsulfanylethane is sourced from PubChem (CID 154630711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).