About ethylsulfanylethane;2-methylpropane;yttrium(3+)
ethylsulfanylethane;2-methylpropane;yttrium(3+) (PubChem CID 153435739) has the molecular formula C8H17SY
and a molecular weight of 234.20 g/mol. Its IUPAC name is ethylsulfanylethane;2-methylpropane;yttrium(3+).
Molecular Properties
| Compound Name | ethylsulfanylethane;2-methylpropane;yttrium(3+) |
| PubChem CID | 153435739 |
| Molecular Formula | C8H17SY |
| Molecular Weight | 234.20 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | ethylsulfanylethane;2-methylpropane;yttrium(3+) |
| SMILES | C[C-](C)C.[CH2-]CSC[CH2-].[Y+3] |
| InChI | InChI=1S/C4H8S.C4H9.Y/c1-3-5-4-2;1-4(2)3;/h1-4H2;1-3H3;/q-2;-1;+3 |
| InChIKey | MZLNVRVMCMMEPS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.20 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethylsulfanylethane;2-methylpropane;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylsulfanylethane;2-methylpropane;yttrium(3+)?
The IUPAC name of ethylsulfanylethane;2-methylpropane;yttrium(3+) (CID 153435739) is ethylsulfanylethane;2-methylpropane;yttrium(3+).
What is the SMILES notation for ethylsulfanylethane;2-methylpropane;yttrium(3+)?
The canonical SMILES for ethylsulfanylethane;2-methylpropane;yttrium(3+) is C[C-](C)C.[CH2-]CSC[CH2-].[Y+3].
What is the InChIKey of ethylsulfanylethane;2-methylpropane;yttrium(3+)?
The InChIKey is MZLNVRVMCMMEPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8S.C4H9.Y/c1-3-5-4-2;1-4(2)3;/h1-4H2;1-3H3;/q-2;-1;+3.
What are the key properties of ethylsulfanylethane;2-methylpropane;yttrium(3+)?
ethylsulfanylethane;2-methylpropane;yttrium(3+) has a molecular weight of 234.20 g/mol, XLogP of 3.01, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethylsulfanylethane;2-methylpropane;yttrium(3+) is sourced from PubChem (CID 153435739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).