C12H25Y — CID 59555473
3-methanidyl-2,2-dimethylpentane;2-methylpropane;yttrium(3+) (PubChem CID 59555473) has the molecular formula C12H25Y and a molecular weight of 258.24 g/mol. Its IUPAC name is 3-methanidyl-2,2-dimethylpentane;2-methylpropane;yttrium(3+).
| Compound Name | 3-methanidyl-2,2-dimethylpentane;2-methylpropane;yttrium(3+) |
|---|---|
| PubChem CID | 59555473 |
| Molecular Formula | C12H25Y |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 3-methanidyl-2,2-dimethylpentane;2-methylpropane;yttrium(3+) |
| SMILES | C[C-](C)C.[CH2-]CC([CH2-])C(C)(C)C.[Y+3] |
| InChI | InChI=1S/C8H16.C4H9.Y/c1-6-7(2)8(3,4)5;1-4(2)3;/h7H,1-2,6H2,3-5H3;1-3H3;/q-2;-1;+3 |
| InChIKey | XVJHEQWRHPKDSP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|