About 4-(2,6-dichlorophenyl)-2-(3-methoxyoxetan-3-yl)-1H-pyrrole-3-carboxylic acid
4-(2,6-dichlorophenyl)-2-(3-methoxyoxetan-3-yl)-1H-pyrrole-3-carboxylic acid (PubChem CID 154631996) has the molecular formula C15H13Cl2NO4
and a molecular weight of 342.18 g/mol. Its IUPAC name is 4-(2,6-dichlorophenyl)-2-(3-methoxyoxetan-3-yl)-1H-pyrrole-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-(2,6-dichlorophenyl)-2-(3-methoxyoxetan-3-yl)-1H-pyrrole-3-carboxylic acid |
| PubChem CID | 154631996 |
| Molecular Formula | C15H13Cl2NO4 |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 4-(2,6-dichlorophenyl)-2-(3-methoxyoxetan-3-yl)-1H-pyrrole-3-carboxylic acid |
| SMILES | COC1(c2[nH]cc(-c3c(Cl)cccc3Cl)c2C(=O)O)COC1 |
| InChI | InChI=1S/C15H13Cl2NO4/c1-21-15(6-22-7-15)13-12(14(19)20)8(5-18-13)11-9(16)3-2-4-10(11)17/h2-5,18H,6-7H2,1H3,(H,19,20) |
| InChIKey | WYLNMTXVUKFICE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2,6-dichlorophenyl)-2-(3-methoxyoxetan-3-yl)-1H-pyrrole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,6-dichlorophenyl)-2-(3-methoxyoxetan-3-yl)-1H-pyrrole-3-carboxylic acid?
The IUPAC name of 4-(2,6-dichlorophenyl)-2-(3-methoxyoxetan-3-yl)-1H-pyrrole-3-carboxylic acid (CID 154631996) is 4-(2,6-dichlorophenyl)-2-(3-methoxyoxetan-3-yl)-1H-pyrrole-3-carboxylic acid.
What is the SMILES notation for 4-(2,6-dichlorophenyl)-2-(3-methoxyoxetan-3-yl)-1H-pyrrole-3-carboxylic acid?
The canonical SMILES for 4-(2,6-dichlorophenyl)-2-(3-methoxyoxetan-3-yl)-1H-pyrrole-3-carboxylic acid is COC1(c2[nH]cc(-c3c(Cl)cccc3Cl)c2C(=O)O)COC1.
What is the InChIKey of 4-(2,6-dichlorophenyl)-2-(3-methoxyoxetan-3-yl)-1H-pyrrole-3-carboxylic acid?
The InChIKey is WYLNMTXVUKFICE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Cl2NO4/c1-21-15(6-22-7-15)13-12(14(19)20)8(5-18-13)11-9(16)3-2-4-10(11)17/h2-5,18H,6-7H2,1H3,(H,19,20).
What are the key properties of 4-(2,6-dichlorophenyl)-2-(3-methoxyoxetan-3-yl)-1H-pyrrole-3-carboxylic acid?
4-(2,6-dichlorophenyl)-2-(3-methoxyoxetan-3-yl)-1H-pyrrole-3-carboxylic acid has a molecular weight of 342.18 g/mol, XLogP of 3.56, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,6-dichlorophenyl)-2-(3-methoxyoxetan-3-yl)-1H-pyrrole-3-carboxylic acid is sourced from PubChem (CID 154631996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).