C24H24ClN7O — CID 154632928
2-[2-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]ethylamino]-3-methyl-6-pyrimidin-4-ylpyrimidin-4-one (PubChem CID 154632928) has the molecular formula C24H24ClN7O and a molecular weight of 461.96 g/mol. Its IUPAC name is 2-[2-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]ethylamino]-3-methyl-6-pyrimidin-4-ylpyrimidin-4-one.
| Compound Name | 2-[2-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]ethylamino]-3-methyl-6-pyrimidin-4-ylpyrimidin-4-one |
|---|---|
| PubChem CID | 154632928 |
| Molecular Formula | C24H24ClN7O |
| Molecular Weight | 461.96 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 2-[2-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]ethylamino]-3-methyl-6-pyrimidin-4-ylpyrimidin-4-one |
| SMILES | Cn1c(NCCNc2c3c(nc4cc(Cl)ccc24)CCCC3)nc(-c2ccncn2)cc1=O |
| InChI | InChI=1S/C24H24ClN7O/c1-32-22(33)13-21(19-8-9-26-14-29-19)31-24(32)28-11-10-27-23-16-4-2-3-5-18(16)30-20-12-15(25)6-7-17(20)23/h6-9,12-14H,2-5,10-11H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | TXPSKLWBTUAZNW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.96 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|