C25H23FN6O3 — CID 154633010
N-[3-[[4-[4-(4-fluorophenyl)-2-(2-hydroxyethyl)-1H-imidazol-5-yl]pyrimidin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide (PubChem CID 154633010) has the molecular formula C25H23FN6O3 and a molecular weight of 474.50 g/mol. Its IUPAC name is N-[3-[[4-[4-(4-fluorophenyl)-2-(2-hydroxyethyl)-1H-imidazol-5-yl]pyrimidin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[3-[[4-[4-(4-fluorophenyl)-2-(2-hydroxyethyl)-1H-imidazol-5-yl]pyrimidin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 154633010 |
| Molecular Formula | C25H23FN6O3 |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | N-[3-[[4-[4-(4-fluorophenyl)-2-(2-hydroxyethyl)-1H-imidazol-5-yl]pyrimidin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(OC)c(Nc2nccc(-c3[nH]c(CCO)nc3-c3ccc(F)cc3)n2)c1 |
| InChI | InChI=1S/C25H23FN6O3/c1-3-22(34)28-17-8-9-20(35-2)19(14-17)30-25-27-12-10-18(29-25)24-23(31-21(32-24)11-13-33)15-4-6-16(26)7-5-15/h3-10,12,14,33H,1,11,13H2,2H3,(H,28,34)(H,31,32)(H,27,29,30) |
| InChIKey | OBJNKCCVNBAELE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 125.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|